C37H34O3S2 — CID 147849842
(5E)-2-[(E)-(2-tert-butyl-6-phenylthiopyran-4-ylidene)methyl]-5-[(2-tert-butyl-6-phenylthiopyrylium-4-yl)methylidene]-3,4-dioxocyclopenten-1-olate (PubChem CID 147849842) has the molecular formula C37H34O3S2 and a molecular weight of 590.81 g/mol. Its IUPAC name is (5E)-2-[(E)-(2-tert-butyl-6-phenylthiopyran-4-ylidene)methyl]-5-[(2-tert-butyl-6-phenylthiopyrylium-4-yl)methylidene]-3,4-dioxocyclopenten-1-olate.
| Compound Name | (5E)-2-[(E)-(2-tert-butyl-6-phenylthiopyran-4-ylidene)methyl]-5-[(2-tert-butyl-6-phenylthiopyrylium-4-yl)methylidene]-3,4-dioxocyclopenten-1-olate |
|---|---|
| PubChem CID | 147849842 |
| Molecular Formula | C37H34O3S2 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | (5E)-2-[(E)-(2-tert-butyl-6-phenylthiopyran-4-ylidene)methyl]-5-[(2-tert-butyl-6-phenylthiopyrylium-4-yl)methylidene]-3,4-dioxocyclopenten-1-olate |
| SMILES | CC(C)(C)C1=C/C(=C\C2=C([O-])/C(=C\c3cc(-c4ccccc4)[s+]c(C(C)(C)C)c3)C(=O)C2=O)C=C(c2ccccc2)S1 |
| InChI | InChI=1S/C37H34O3S2/c1-36(2,3)31-21-23(19-29(41-31)25-13-9-7-10-14-25)17-27-33(38)28(35(40)34(27)39)18-24-20-30(26-15-11-8-12-16-26)42-32(22-24)37(4,5)6/h7-22H,1-6H3 |
| InChIKey | HUPITJHDDGBFNW-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|