C36H34O2Se2- — CID 58741818
CID 58741818 (PubChem CID 58741818) has the molecular formula C36H34O2Se2- and a molecular weight of 656.59 g/mol.
| Compound Name | CID 58741818 |
|---|---|
| PubChem CID | 58741818 |
| Molecular Formula | C36H34O2Se2- |
| Molecular Weight | 656.59 g/mol |
| Exact Mass | 658.09 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C1=CC(=CC2=C([O-])C(=CC3=CC(c4ccccc4)=[Se]C(C(C)(C)C)=C3)C2=O)C=C(c2ccccc2)[Se]1 |
| InChI | InChI=1S/C36H35O2Se2/c1-35(2,3)31-21-23(19-29(39-31)25-13-9-7-10-14-25)17-27-33(37)28(34(27)38)18-24-20-30(26-15-11-8-12-16-26)40-32(22-24)36(4,5)6/h7-22,37H,1-6H3/p-1 |
| InChIKey | XEPBIJJOOCCMOI-UHFFFAOYSA-M |
| XLogP | 6.52 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.59 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|