C41H58O3S2 — CID 58925424
2-[(2,6-dihexylthiopyran-4-ylidene)methyl]-5-[(2,6-dihexylthiopyrylium-4-yl)methylidene]-3,4-dioxocyclopenten-1-olate (PubChem CID 58925424) has the molecular formula C41H58O3S2 and a molecular weight of 663.05 g/mol. Its IUPAC name is 2-[(2,6-dihexylthiopyran-4-ylidene)methyl]-5-[(2,6-dihexylthiopyrylium-4-yl)methylidene]-3,4-dioxocyclopenten-1-olate.
| Compound Name | 2-[(2,6-dihexylthiopyran-4-ylidene)methyl]-5-[(2,6-dihexylthiopyrylium-4-yl)methylidene]-3,4-dioxocyclopenten-1-olate |
|---|---|
| PubChem CID | 58925424 |
| Molecular Formula | C41H58O3S2 |
| Molecular Weight | 663.05 g/mol |
| Exact Mass | 662.38 |
| IUPAC Name | 2-[(2,6-dihexylthiopyran-4-ylidene)methyl]-5-[(2,6-dihexylthiopyrylium-4-yl)methylidene]-3,4-dioxocyclopenten-1-olate |
| SMILES | CCCCCCC1=CC(=CC2=C([O-])C(=Cc3cc(CCCCCC)[s+]c(CCCCCC)c3)C(=O)C2=O)C=C(CCCCCC)S1 |
| InChI | InChI=1S/C41H58O3S2/c1-5-9-13-17-21-33-25-31(26-34(45-33)22-18-14-10-6-2)29-37-39(42)38(41(44)40(37)43)30-32-27-35(23-19-15-11-7-3)46-36(28-32)24-20-16-12-8-4/h25-30H,5-24H2,1-4H3 |
| InChIKey | DAHOJWPFULTZGK-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.05 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|