C36H51O2S2+ — CID 140670486
2-[(2,6-dipentylthiopyran-4-ylidene)methyl]-4-[(2,6-dipentylthiopyrylium-4-yl)methylidene]-3-hydroxycyclobut-2-en-1-one (PubChem CID 140670486) has the molecular formula C36H51O2S2+ and a molecular weight of 579.94 g/mol. Its IUPAC name is 2-[(2,6-dipentylthiopyran-4-ylidene)methyl]-4-[(2,6-dipentylthiopyrylium-4-yl)methylidene]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | 2-[(2,6-dipentylthiopyran-4-ylidene)methyl]-4-[(2,6-dipentylthiopyrylium-4-yl)methylidene]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 140670486 |
| Molecular Formula | C36H51O2S2+ |
| Molecular Weight | 579.94 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | 2-[(2,6-dipentylthiopyran-4-ylidene)methyl]-4-[(2,6-dipentylthiopyrylium-4-yl)methylidene]-3-hydroxycyclobut-2-en-1-one |
| SMILES | CCCCCC1=CC(=CC2=C(O)C(=Cc3cc(CCCCC)[s+]c(CCCCC)c3)C2=O)C=C(CCCCC)S1 |
| InChI | InChI=1S/C36H50O2S2/c1-5-9-13-17-29-21-27(22-30(39-29)18-14-10-6-2)25-33-35(37)34(36(33)38)26-28-23-31(19-15-11-7-3)40-32(24-28)20-16-12-8-4/h21-26H,5-20H2,1-4H3/p+1 |
| InChIKey | HAOKSZVGHUDVEO-UHFFFAOYSA-O |
| XLogP | 11.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.94 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|