C19H24O2 — CID 8882672
(5E)-5-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-2-pentylcyclopent-2-en-1-one (PubChem CID 8882672) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (5E)-5-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-2-pentylcyclopent-2-en-1-one.
| Compound Name | (5E)-5-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-2-pentylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 8882672 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (5E)-5-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-2-pentylcyclopent-2-en-1-one |
| SMILES | CCCCCC1=CC/C(=C\c2cc(C)c(O)c(C)c2)C1=O |
| InChI | InChI=1S/C19H24O2/c1-4-5-6-7-16-8-9-17(19(16)21)12-15-10-13(2)18(20)14(3)11-15/h8,10-12,20H,4-7,9H2,1-3H3/b17-12+ |
| InChIKey | HYGIIZJAOQGENR-SFQUDFHCSA-N |
| XLogP | 4.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|