C54H70O4 — CID 140670475
2-[[2-(4-octylphenyl)-6-pentylpyran-4-ylidene]methyl]-4-[[2-(4-octylphenyl)-6-pentylpyrylium-4-yl]methylidene]-3-oxocyclobuten-1-olate (PubChem CID 140670475) has the molecular formula C54H70O4 and a molecular weight of 783.15 g/mol. Its IUPAC name is 2-[[2-(4-octylphenyl)-6-pentylpyran-4-ylidene]methyl]-4-[[2-(4-octylphenyl)-6-pentylpyrylium-4-yl]methylidene]-3-oxocyclobuten-1-olate.
| Compound Name | 2-[[2-(4-octylphenyl)-6-pentylpyran-4-ylidene]methyl]-4-[[2-(4-octylphenyl)-6-pentylpyrylium-4-yl]methylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 140670475 |
| Molecular Formula | C54H70O4 |
| Molecular Weight | 783.15 g/mol |
| Exact Mass | 782.53 |
| IUPAC Name | 2-[[2-(4-octylphenyl)-6-pentylpyran-4-ylidene]methyl]-4-[[2-(4-octylphenyl)-6-pentylpyrylium-4-yl]methylidene]-3-oxocyclobuten-1-olate |
| SMILES | CCCCCCCCc1ccc(C2=CC(=CC3=C([O-])C(=Cc4cc(CCCCC)[o+]c(-c5ccc(CCCCCCCC)cc5)c4)C3=O)C=C(CCCCC)O2)cc1 |
| InChI | InChI=1S/C54H70O4/c1-5-9-13-15-17-21-23-41-27-31-45(32-28-41)51-39-43(35-47(57-51)25-19-11-7-3)37-49-53(55)50(54(49)56)38-44-36-48(26-20-12-8-4)58-52(40-44)46-33-29-42(30-34-46)24-22-18-16-14-10-6-2/h27-40H,5-26H2,1-4H3 |
| InChIKey | LAWKEGWHULDKAA-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.15 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|