C22H22BrNO2 — CID 6297754
(4Z)-4-[(4-bromophenyl)methylidene]-2-(4-hexylphenyl)-1,3-oxazol-5-one (PubChem CID 6297754) has the molecular formula C22H22BrNO2 and a molecular weight of 412.33 g/mol. Its IUPAC name is (4Z)-4-[(4-bromophenyl)methylidene]-2-(4-hexylphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(4-bromophenyl)methylidene]-2-(4-hexylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6297754 |
| Molecular Formula | C22H22BrNO2 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | (4Z)-4-[(4-bromophenyl)methylidene]-2-(4-hexylphenyl)-1,3-oxazol-5-one |
| SMILES | CCCCCCc1ccc(C2=N/C(=C\c3ccc(Br)cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C22H22BrNO2/c1-2-3-4-5-6-16-7-11-18(12-8-16)21-24-20(22(25)26-21)15-17-9-13-19(23)14-10-17/h7-15H,2-6H2,1H3/b20-15- |
| InChIKey | AWKKTOFXINDFDD-HKWRFOASSA-N |
| XLogP | 5.92 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|