C32H35NO4 — CID 3534206
4-[(3,4-dimethoxyphenyl)methylidene]-2-[4-(4-octylphenyl)phenyl]-1,3-oxazol-5-one (PubChem CID 3534206) has the molecular formula C32H35NO4 and a molecular weight of 497.64 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methylidene]-2-[4-(4-octylphenyl)phenyl]-1,3-oxazol-5-one.
| Compound Name | 4-[(3,4-dimethoxyphenyl)methylidene]-2-[4-(4-octylphenyl)phenyl]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3534206 |
| Molecular Formula | C32H35NO4 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)methylidene]-2-[4-(4-octylphenyl)phenyl]-1,3-oxazol-5-one |
| SMILES | CCCCCCCCc1ccc(-c2ccc(C3=NC(=Cc4ccc(OC)c(OC)c4)C(=O)O3)cc2)cc1 |
| InChI | InChI=1S/C32H35NO4/c1-4-5-6-7-8-9-10-23-11-14-25(15-12-23)26-16-18-27(19-17-26)31-33-28(32(34)37-31)21-24-13-20-29(35-2)30(22-24)36-3/h11-22H,4-10H2,1-3H3 |
| InChIKey | QVAWMUVQNRSRRL-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|