C30H30ClNO2 — CID 4536887
4-[(2-chlorophenyl)methylidene]-2-[4-(4-octylphenyl)phenyl]-1,3-oxazol-5-one (PubChem CID 4536887) has the molecular formula C30H30ClNO2 and a molecular weight of 472.03 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methylidene]-2-[4-(4-octylphenyl)phenyl]-1,3-oxazol-5-one.
| Compound Name | 4-[(2-chlorophenyl)methylidene]-2-[4-(4-octylphenyl)phenyl]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4536887 |
| Molecular Formula | C30H30ClNO2 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 4-[(2-chlorophenyl)methylidene]-2-[4-(4-octylphenyl)phenyl]-1,3-oxazol-5-one |
| SMILES | CCCCCCCCc1ccc(-c2ccc(C3=NC(=Cc4ccccc4Cl)C(=O)O3)cc2)cc1 |
| InChI | InChI=1S/C30H30ClNO2/c1-2-3-4-5-6-7-10-22-13-15-23(16-14-22)24-17-19-25(20-18-24)29-32-28(30(33)34-29)21-26-11-8-9-12-27(26)31/h8-9,11-21H,2-7,10H2,1H3 |
| InChIKey | VSXGHOITJGZLFG-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|