C23H24ClNO3 — CID 4309969
2-(3-chlorophenyl)-4-[(2-heptoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 4309969) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-[(2-heptoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(3-chlorophenyl)-4-[(2-heptoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4309969 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-(3-chlorophenyl)-4-[(2-heptoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCCCCCCOc1ccccc1C=C1N=C(c2cccc(Cl)c2)OC1=O |
| InChI | InChI=1S/C23H24ClNO3/c1-2-3-4-5-8-14-27-21-13-7-6-10-17(21)16-20-23(26)28-22(25-20)18-11-9-12-19(24)15-18/h6-7,9-13,15-16H,2-5,8,14H2,1H3 |
| InChIKey | SFRWWNJHFMEVIQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|