C25H20ClNO5 — CID 4198765
4-[[5-chloro-2-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 4198765) has the molecular formula C25H20ClNO5 and a molecular weight of 449.89 g/mol. Its IUPAC name is 4-[[5-chloro-2-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | 4-[[5-chloro-2-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4198765 |
| Molecular Formula | C25H20ClNO5 |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 4-[[5-chloro-2-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | COc1ccccc1OCCOc1ccc(Cl)cc1C=C1N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C25H20ClNO5/c1-29-22-9-5-6-10-23(22)31-14-13-30-21-12-11-19(26)15-18(21)16-20-25(28)32-24(27-20)17-7-3-2-4-8-17/h2-12,15-16H,13-14H2,1H3 |
| InChIKey | ATJSNIMGDIFDRD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|