C26H23NO6 — CID 4280278
4-[[5-methoxy-2-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 4280278) has the molecular formula C26H23NO6 and a molecular weight of 445.47 g/mol. Its IUPAC name is 4-[[5-methoxy-2-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | 4-[[5-methoxy-2-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 4280278 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-[[5-methoxy-2-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | COc1ccc(OCCOc2ccccc2OC)c(C=C2N=C(c3ccccc3)OC2=O)c1 |
| InChI | InChI=1S/C26H23NO6/c1-29-20-12-13-22(31-14-15-32-24-11-7-6-10-23(24)30-2)19(16-20)17-21-26(28)33-25(27-21)18-8-4-3-5-9-18/h3-13,16-17H,14-15H2,1-2H3 |
| InChIKey | RHSMHMLKLMWUHK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|