C25H21NO5 — CID 2288862
(4Z)-4-[[4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one (PubChem CID 2288862) has the molecular formula C25H21NO5 and a molecular weight of 415.45 g/mol. Its IUPAC name is (4Z)-4-[[4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2288862 |
| Molecular Formula | C25H21NO5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | (4Z)-4-[[4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-phenyl-1,3-oxazol-5-one |
| SMILES | COc1cccc(OCCOc2ccc(/C=C3\N=C(c4ccccc4)OC3=O)cc2)c1 |
| InChI | InChI=1S/C25H21NO5/c1-28-21-8-5-9-22(17-21)30-15-14-29-20-12-10-18(11-13-20)16-23-25(27)31-24(26-23)19-6-3-2-4-7-19/h2-13,16-17H,14-15H2,1H3/b23-16- |
| InChIKey | ROUQBRQOGZIWNQ-KQWNVCNZSA-N |
| XLogP | 4.50 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|