C27H24FNO6 — CID 2934023
4-[[3-ethoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-(4-fluorophenyl)-1,3-oxazol-5-one (PubChem CID 2934023) has the molecular formula C27H24FNO6 and a molecular weight of 477.49 g/mol. Its IUPAC name is 4-[[3-ethoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-(4-fluorophenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[[3-ethoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-(4-fluorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2934023 |
| Molecular Formula | C27H24FNO6 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 4-[[3-ethoxy-4-[2-(3-methoxyphenoxy)ethoxy]phenyl]methylidene]-2-(4-fluorophenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1cc(C=C2N=C(c3ccc(F)cc3)OC2=O)ccc1OCCOc1cccc(OC)c1 |
| InChI | InChI=1S/C27H24FNO6/c1-3-32-25-16-18(15-23-27(30)35-26(29-23)19-8-10-20(28)11-9-19)7-12-24(25)34-14-13-33-22-6-4-5-21(17-22)31-2/h4-12,15-17H,3,13-14H2,1-2H3 |
| InChIKey | NJBSLILHXSRJAK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|