C26H20FNO6 — CID 3972924
[2-ethoxy-4-[[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methoxybenzoate (PubChem CID 3972924) has the molecular formula C26H20FNO6 and a molecular weight of 461.45 g/mol. Its IUPAC name is [2-ethoxy-4-[[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methoxybenzoate.
| Compound Name | [2-ethoxy-4-[[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 3972924 |
| Molecular Formula | C26H20FNO6 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [2-ethoxy-4-[[2-(4-fluorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-methoxybenzoate |
| SMILES | CCOc1cc(C=C2N=C(c3ccc(F)cc3)OC2=O)ccc1OC(=O)c1ccccc1OC |
| InChI | InChI=1S/C26H20FNO6/c1-3-32-23-15-16(8-13-22(23)33-25(29)19-6-4-5-7-21(19)31-2)14-20-26(30)34-24(28-20)17-9-11-18(27)12-10-17/h4-15H,3H2,1-2H3 |
| InChIKey | LVDGFSQZDQVQNA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|