C25H29NO3 — CID 3107322
2-(4-tert-butylphenyl)-4-[(2-pentoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 3107322) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-4-[(2-pentoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | 2-(4-tert-butylphenyl)-4-[(2-pentoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3107322 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 2-(4-tert-butylphenyl)-4-[(2-pentoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCCCCOc1ccccc1C=C1N=C(c2ccc(C(C)(C)C)cc2)OC1=O |
| InChI | InChI=1S/C25H29NO3/c1-5-6-9-16-28-22-11-8-7-10-19(22)17-21-24(27)29-23(26-21)18-12-14-20(15-13-18)25(2,3)4/h7-8,10-15,17H,5-6,9,16H2,1-4H3 |
| InChIKey | NXEMKYNCBZMMHN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|