C21H20INO3 — CID 19671930
(4Z)-4-[(2-butoxyphenyl)methylidene]-2-(4-iodo-3-methylphenyl)-1,3-oxazol-5-one (PubChem CID 19671930) has the molecular formula C21H20INO3 and a molecular weight of 461.30 g/mol. Its IUPAC name is (4Z)-4-[(2-butoxyphenyl)methylidene]-2-(4-iodo-3-methylphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(2-butoxyphenyl)methylidene]-2-(4-iodo-3-methylphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19671930 |
| Molecular Formula | C21H20INO3 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | (4Z)-4-[(2-butoxyphenyl)methylidene]-2-(4-iodo-3-methylphenyl)-1,3-oxazol-5-one |
| SMILES | CCCCOc1ccccc1/C=C1\N=C(c2ccc(I)c(C)c2)OC1=O |
| InChI | InChI=1S/C21H20INO3/c1-3-4-11-25-19-8-6-5-7-15(19)13-18-21(24)26-20(23-18)16-9-10-17(22)14(2)12-16/h5-10,12-13H,3-4,11H2,1-2H3/b18-13- |
| InChIKey | NNJQZUSEHDTVNS-AQTBWJFISA-N |
| XLogP | 5.12 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|