C25H29NO5 — CID 2436579
(4E)-2-(4-ethoxyphenyl)-4-[(4-hexoxy-3-methoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 2436579) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is (4E)-2-(4-ethoxyphenyl)-4-[(4-hexoxy-3-methoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(4-ethoxyphenyl)-4-[(4-hexoxy-3-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2436579 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (4E)-2-(4-ethoxyphenyl)-4-[(4-hexoxy-3-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCCCCCOc1ccc(/C=C2/N=C(c3ccc(OCC)cc3)OC2=O)cc1OC |
| InChI | InChI=1S/C25H29NO5/c1-4-6-7-8-15-30-22-14-9-18(17-23(22)28-3)16-21-25(27)31-24(26-21)19-10-12-20(13-11-19)29-5-2/h9-14,16-17H,4-8,15H2,1-3H3/b21-16+ |
| InChIKey | YNOBNSGZJFDXBD-LTGZKZEYSA-N |
| XLogP | 5.40 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|