C26H22ClNO5 — CID 3488822
4-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 3488822) has the molecular formula C26H22ClNO5 and a molecular weight of 463.92 g/mol. Its IUPAC name is 4-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | 4-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 3488822 |
| Molecular Formula | C26H22ClNO5 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 4-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(C2=NC(=Cc3ccc(OCc4ccc(Cl)cc4)c(OC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C26H22ClNO5/c1-3-31-21-11-7-19(8-12-21)25-28-22(26(29)33-25)14-18-6-13-23(24(15-18)30-2)32-16-17-4-9-20(27)10-5-17/h4-15H,3,16H2,1-2H3 |
| InChIKey | OJTJAIMABRBGSI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|