C26H21Cl2NO5 — CID 126015319
(4Z)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one (PubChem CID 126015319) has the molecular formula C26H21Cl2NO5 and a molecular weight of 498.36 g/mol. Its IUPAC name is (4Z)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 126015319 |
| Molecular Formula | C26H21Cl2NO5 |
| Molecular Weight | 498.36 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | (4Z)-4-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-ethoxyphenyl)-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(C2=N/C(=C\c3ccc(OCc4ccc(Cl)cc4Cl)c(OC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C26H21Cl2NO5/c1-3-32-20-9-6-17(7-10-20)25-29-22(26(30)34-25)12-16-4-11-23(24(13-16)31-2)33-15-18-5-8-19(27)14-21(18)28/h4-14H,3,15H2,1-2H3/b22-12- |
| InChIKey | CFGMDHHJANZNKT-UUYOSTAYSA-N |
| XLogP | 6.32 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.36 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|