C28H26ClNO5 — CID 126010683
(4Z)-2-(4-butoxyphenyl)-4-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 126010683) has the molecular formula C28H26ClNO5 and a molecular weight of 491.97 g/mol. Its IUPAC name is (4Z)-2-(4-butoxyphenyl)-4-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(4-butoxyphenyl)-4-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 126010683 |
| Molecular Formula | C28H26ClNO5 |
| Molecular Weight | 491.97 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | (4Z)-2-(4-butoxyphenyl)-4-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CCCCOc1ccc(C2=N/C(=C\c3ccc(OCc4ccc(Cl)cc4)c(OC)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C28H26ClNO5/c1-3-4-15-33-23-12-8-21(9-13-23)27-30-24(28(31)35-27)16-20-7-14-25(26(17-20)32-2)34-18-19-5-10-22(29)11-6-19/h5-14,16-17H,3-4,15,18H2,1-2H3/b24-16- |
| InChIKey | NYKGJHSBXJRDEJ-JLPGSUDCSA-N |
| XLogP | 6.45 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.97 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|