About cadmium(2+);bis(4-decylphenolate)
cadmium(2+);bis(4-decylphenolate) (PubChem CID 101292611) has the molecular formula C32H50CdO2
and a molecular weight of 579.16 g/mol. Its IUPAC name is cadmium(2+);bis(4-decylphenolate).
Molecular Properties
| Compound Name | cadmium(2+);bis(4-decylphenolate) |
| PubChem CID | 101292611 |
| Molecular Formula | C32H50CdO2 |
| Molecular Weight | 579.16 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | cadmium(2+);bis(4-decylphenolate) |
| SMILES | CCCCCCCCCCc1ccc([O-])cc1.CCCCCCCCCCc1ccc([O-])cc1.[Cd+2] |
| InChI | InChI=1S/2C16H26O.Cd/c2*1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15;/h2*11-14,17H,2-10H2,1H3;/q;;+2/p-2 |
| InChIKey | OSYTWMXYZIZLME-UHFFFAOYSA-L |
| XLogP | 8.88 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 579.16 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cadmium(2+);bis(4-decylphenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);bis(4-decylphenolate)?
The IUPAC name of cadmium(2+);bis(4-decylphenolate) (CID 101292611) is cadmium(2+);bis(4-decylphenolate).
What is the SMILES notation for cadmium(2+);bis(4-decylphenolate)?
The canonical SMILES for cadmium(2+);bis(4-decylphenolate) is CCCCCCCCCCc1ccc([O-])cc1.CCCCCCCCCCc1ccc([O-])cc1.[Cd+2].
What is the InChIKey of cadmium(2+);bis(4-decylphenolate)?
The InChIKey is OSYTWMXYZIZLME-UHFFFAOYSA-L. The full InChI is InChI=1S/2C16H26O.Cd/c2*1-2-3-4-5-6-7-8-9-10-15-11-13-16(17)14-12-15;/h2*11-14,17H,2-10H2,1H3;/q;;+2/p-2.
What are the key properties of cadmium(2+);bis(4-decylphenolate)?
cadmium(2+);bis(4-decylphenolate) has a molecular weight of 579.16 g/mol, XLogP of 8.88, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);bis(4-decylphenolate) is sourced from PubChem (CID 101292611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).