C35H41O4S+ — CID 58741846
4-[[2-tert-butyl-6-(4-methoxyphenyl)pyrylium-4-yl]methylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one (PubChem CID 58741846) has the molecular formula C35H41O4S+ and a molecular weight of 557.78 g/mol. Its IUPAC name is 4-[[2-tert-butyl-6-(4-methoxyphenyl)pyrylium-4-yl]methylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | 4-[[2-tert-butyl-6-(4-methoxyphenyl)pyrylium-4-yl]methylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 58741846 |
| Molecular Formula | C35H41O4S+ |
| Molecular Weight | 557.78 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | 4-[[2-tert-butyl-6-(4-methoxyphenyl)pyrylium-4-yl]methylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
| SMILES | COc1ccc(-c2cc(C=C3C(=O)C(C=C4C=C(C(C)(C)C)SC(C(C)(C)C)=C4)=C3O)cc(C(C)(C)C)[o+]2)cc1 |
| InChI | InChI=1S/C35H40O4S/c1-33(2,3)28-18-21(17-27(39-28)23-11-13-24(38-10)14-12-23)15-25-31(36)26(32(25)37)16-22-19-29(34(4,5)6)40-30(20-22)35(7,8)9/h11-20H,1-10H3/p+1 |
| InChIKey | YPGYOUMEGIOODW-UHFFFAOYSA-O |
| XLogP | 9.85 |
| TPSA | 57.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.78 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|