C35H42N2O2S — CID 139245136
[2-cyano-2-[(4Z)-2-[(2,6-ditert-butylpyran-4-ylidene)methyl]-4-[(2,6-ditert-butylpyrylium-4-yl)methylidene]-3-sulfanylidenecyclobuten-1-yl]ethenylidene]azanide (PubChem CID 139245136) has the molecular formula C35H42N2O2S and a molecular weight of 554.80 g/mol. Its IUPAC name is [2-cyano-2-[(4Z)-2-[(2,6-ditert-butylpyran-4-ylidene)methyl]-4-[(2,6-ditert-butylpyrylium-4-yl)methylidene]-3-sulfanylidenecyclobuten-1-yl]ethenylidene]azanide.
| Compound Name | [2-cyano-2-[(4Z)-2-[(2,6-ditert-butylpyran-4-ylidene)methyl]-4-[(2,6-ditert-butylpyrylium-4-yl)methylidene]-3-sulfanylidenecyclobuten-1-yl]ethenylidene]azanide |
|---|---|
| PubChem CID | 139245136 |
| Molecular Formula | C35H42N2O2S |
| Molecular Weight | 554.80 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | [2-cyano-2-[(4Z)-2-[(2,6-ditert-butylpyran-4-ylidene)methyl]-4-[(2,6-ditert-butylpyrylium-4-yl)methylidene]-3-sulfanylidenecyclobuten-1-yl]ethenylidene]azanide |
| SMILES | CC(C)(C)C1=CC(=CC2=C(C(=C=[N-])C#N)/C(=C/c3cc(C(C)(C)C)[o+]c(C(C)(C)C)c3)C2=S)C=C(C(C)(C)C)O1 |
| InChI | InChI=1S/C35H42N2O2S/c1-32(2,3)26-15-21(16-27(38-26)33(4,5)6)13-24-30(23(19-36)20-37)25(31(24)40)14-22-17-28(34(7,8)9)39-29(18-22)35(10,11)12/h13-18H,1-12H3 |
| InChIKey | NDWOLPKLMRYLKF-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 66.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.80 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|