C22H29O+ — CID 53422956
2,6-ditert-butyl-4-[2-(4-methylphenyl)ethenyl]pyrylium (PubChem CID 53422956) has the molecular formula C22H29O+ and a molecular weight of 309.47 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-(4-methylphenyl)ethenyl]pyrylium.
| Compound Name | 2,6-ditert-butyl-4-[2-(4-methylphenyl)ethenyl]pyrylium |
|---|---|
| PubChem CID | 53422956 |
| Molecular Formula | C22H29O+ |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-(4-methylphenyl)ethenyl]pyrylium |
| SMILES | Cc1ccc(C=Cc2cc(C(C)(C)C)[o+]c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C22H29O/c1-16-8-10-17(11-9-16)12-13-18-14-19(21(2,3)4)23-20(15-18)22(5,6)7/h8-15H,1-7H3/q+1 |
| InChIKey | APTRMBCTASDPEG-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|