C32H30 — CID 158075827
1-[(E)-2-[4-[4-[(E)-2-(3,5-dimethylphenyl)ethenyl]phenyl]phenyl]ethenyl]-3,5-dimethylbenzene (PubChem CID 158075827) has the molecular formula C32H30 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-[(E)-2-[4-[4-[(E)-2-(3,5-dimethylphenyl)ethenyl]phenyl]phenyl]ethenyl]-3,5-dimethylbenzene.
| Compound Name | 1-[(E)-2-[4-[4-[(E)-2-(3,5-dimethylphenyl)ethenyl]phenyl]phenyl]ethenyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 158075827 |
| Molecular Formula | C32H30 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-[(E)-2-[4-[4-[(E)-2-(3,5-dimethylphenyl)ethenyl]phenyl]phenyl]ethenyl]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(/C=C/c2ccc(-c3ccc(/C=C/c4cc(C)cc(C)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C32H30/c1-23-17-24(2)20-29(19-23)7-5-27-9-13-31(14-10-27)32-15-11-28(12-16-32)6-8-30-21-25(3)18-26(4)22-30/h5-22H,1-4H3/b7-5+,8-6+ |
| InChIKey | FIJWZKNXYVHHCK-KQQUZDAGSA-N |
| XLogP | 8.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|