C17H19N — CID 166716573
[3-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methanamine (PubChem CID 166716573) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is [3-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methanamine.
| Compound Name | [3-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methanamine |
|---|---|
| PubChem CID | 166716573 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | [3-methyl-5-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methanamine |
| SMILES | Cc1ccc(/C=C/c2cc(C)cc(CN)c2)cc1 |
| InChI | InChI=1S/C17H19N/c1-13-3-5-15(6-4-13)7-8-16-9-14(2)10-17(11-16)12-18/h3-11H,12,18H2,1-2H3/b8-7+ |
| InChIKey | LWYXKRQDZRUYTA-BQYQJAHWSA-N |
| XLogP | 3.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|