C28H30 — CID 10690281
6,15,16-trimethyl-13-[(E)-2-(4-methylphenyl)ethenyl]tricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene (PubChem CID 10690281) has the molecular formula C28H30 and a molecular weight of 366.55 g/mol. Its IUPAC name is 6,15,16-trimethyl-13-[(E)-2-(4-methylphenyl)ethenyl]tricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene.
| Compound Name | 6,15,16-trimethyl-13-[(E)-2-(4-methylphenyl)ethenyl]tricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
|---|---|
| PubChem CID | 10690281 |
| Molecular Formula | C28H30 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 6,15,16-trimethyl-13-[(E)-2-(4-methylphenyl)ethenyl]tricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
| SMILES | Cc1ccc(/C=C/c2cc3c(C)c(c2)CCc2cc(C)cc(c2C)CC3)cc1 |
| InChI | InChI=1S/C28H30/c1-19-5-7-23(8-6-19)9-10-24-17-27-13-11-25-15-20(2)16-26(21(25)3)12-14-28(18-24)22(27)4/h5-10,15-18H,11-14H2,1-4H3/b10-9+ |
| InChIKey | POZPIDJRFITDIP-MDZDMXLPSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|