C28H28O — CID 10571839
15,16-dimethyl-13-[(E)-2-(4-methylphenyl)ethenyl]tricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-6-carbaldehyde (PubChem CID 10571839) has the molecular formula C28H28O and a molecular weight of 380.53 g/mol. Its IUPAC name is 15,16-dimethyl-13-[(E)-2-(4-methylphenyl)ethenyl]tricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-6-carbaldehyde.
| Compound Name | 15,16-dimethyl-13-[(E)-2-(4-methylphenyl)ethenyl]tricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-6-carbaldehyde |
|---|---|
| PubChem CID | 10571839 |
| Molecular Formula | C28H28O |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 15,16-dimethyl-13-[(E)-2-(4-methylphenyl)ethenyl]tricyclo[9.3.1.14,8]hexadeca-1(14),4,6,8(16),11(15),12-hexaene-6-carbaldehyde |
| SMILES | Cc1ccc(/C=C/c2cc3c(C)c(c2)CCc2cc(C=O)cc(c2C)CC3)cc1 |
| InChI | InChI=1S/C28H28O/c1-19-4-6-22(7-5-19)8-9-23-14-25-10-12-27-16-24(18-29)17-28(21(27)3)13-11-26(15-23)20(25)2/h4-9,14-18H,10-13H2,1-3H3/b9-8+ |
| InChIKey | WTYKVIFPTZXNJA-CMDGGOBGSA-N |
| XLogP | 6.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|