C26H26O4S2 — CID 76573331
1,4-bis[2-(4-methylphenyl)ethenyl]-2,5-bis(methylsulfonyl)benzene (PubChem CID 76573331) has the molecular formula C26H26O4S2 and a molecular weight of 466.62 g/mol. Its IUPAC name is 1,4-bis[2-(4-methylphenyl)ethenyl]-2,5-bis(methylsulfonyl)benzene.
| Compound Name | 1,4-bis[2-(4-methylphenyl)ethenyl]-2,5-bis(methylsulfonyl)benzene |
|---|---|
| PubChem CID | 76573331 |
| Molecular Formula | C26H26O4S2 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 1,4-bis[2-(4-methylphenyl)ethenyl]-2,5-bis(methylsulfonyl)benzene |
| SMILES | Cc1ccc(C=Cc2cc(S(C)(=O)=O)c(C=Cc3ccc(C)cc3)cc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C26H26O4S2/c1-19-5-9-21(10-6-19)13-15-23-17-26(32(4,29)30)24(18-25(23)31(3,27)28)16-14-22-11-7-20(2)8-12-22/h5-18H,1-4H3 |
| InChIKey | OUBNODUXYZFULY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|