C22H29O2+ — CID 6261641
2,6-ditert-butyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]pyrylium (PubChem CID 6261641) has the molecular formula C22H29O2+ and a molecular weight of 325.47 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]pyrylium.
| Compound Name | 2,6-ditert-butyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]pyrylium |
|---|---|
| PubChem CID | 6261641 |
| Molecular Formula | C22H29O2+ |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 2,6-ditert-butyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]pyrylium |
| SMILES | COc1ccc(/C=C/c2cc(C(C)(C)C)[o+]c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C22H29O2/c1-21(2,3)19-14-17(15-20(24-19)22(4,5)6)9-8-16-10-12-18(23-7)13-11-16/h8-15H,1-7H3/q+1/b9-8+ |
| InChIKey | HFWNTQUOLSTUIF-CMDGGOBGSA-N |
| XLogP | 6.33 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|