C13H18O — CID 10012750
1-[(E)-3,3-dimethylbut-1-enyl]-4-methoxybenzene (PubChem CID 10012750) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-[(E)-3,3-dimethylbut-1-enyl]-4-methoxybenzene.
| Compound Name | 1-[(E)-3,3-dimethylbut-1-enyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 10012750 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 1-[(E)-3,3-dimethylbut-1-enyl]-4-methoxybenzene |
| SMILES | COc1ccc(/C=C/C(C)(C)C)cc1 |
| InChI | InChI=1S/C13H18O/c1-13(2,3)10-9-11-5-7-12(14-4)8-6-11/h5-10H,1-4H3/b10-9+ |
| InChIKey | PUPBRJXHYRTJNQ-MDZDMXLPSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |