C19H20O — CID 123460289
1-methoxy-4-(3-methyl-3-phenylpenta-1,4-dienyl)benzene (PubChem CID 123460289) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-methoxy-4-(3-methyl-3-phenylpenta-1,4-dienyl)benzene.
| Compound Name | 1-methoxy-4-(3-methyl-3-phenylpenta-1,4-dienyl)benzene |
|---|---|
| PubChem CID | 123460289 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-methoxy-4-(3-methyl-3-phenylpenta-1,4-dienyl)benzene |
| SMILES | C=CC(C)(C=Cc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H20O/c1-4-19(2,17-8-6-5-7-9-17)15-14-16-10-12-18(20-3)13-11-16/h4-15H,1H2,2-3H3 |
| InChIKey | DIUHUSKJOGZLLH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|