C19H24OSi — CID 134940079
[(2R)-2-(4-methoxyphenyl)but-3-en-2-yl]-dimethyl-phenylsilane (PubChem CID 134940079) has the molecular formula C19H24OSi and a molecular weight of 296.49 g/mol. Its IUPAC name is [(2R)-2-(4-methoxyphenyl)but-3-en-2-yl]-dimethyl-phenylsilane.
| Compound Name | [(2R)-2-(4-methoxyphenyl)but-3-en-2-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 134940079 |
| Molecular Formula | C19H24OSi |
| Molecular Weight | 296.49 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | [(2R)-2-(4-methoxyphenyl)but-3-en-2-yl]-dimethyl-phenylsilane |
| SMILES | C=C[C@](C)(c1ccc(OC)cc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H24OSi/c1-6-19(2,16-12-14-17(20-3)15-13-16)21(4,5)18-10-8-7-9-11-18/h6-15H,1H2,2-5H3/t19-/m1/s1 |
| InChIKey | YWMAZIVUCLRPQT-LJQANCHMSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|