About CID 135078844
CID 135078844 (PubChem CID 135078844) has the molecular formula C9H9GeO
and a molecular weight of 205.78 g/mol.
Molecular Properties
| Compound Name | CID 135078844 |
| PubChem CID | 135078844 |
| Molecular Formula | C9H9GeO |
| Molecular Weight | 205.78 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | — |
| SMILES | COc1ccc(/C=C/[Ge])cc1 |
| InChI | InChI=1S/C9H9GeO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-7H,1H3/b7-6+ |
| InChIKey | DKEUBIOBKTWNAT-VOTSOKGWSA-N |
| XLogP | 1.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 135078844 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 135078844?
The IUPAC name of CID 135078844 (CID 135078844) is not available.
What is the SMILES notation for CID 135078844?
The canonical SMILES for CID 135078844 is COc1ccc(/C=C/[Ge])cc1.
What is the InChIKey of CID 135078844?
The InChIKey is DKEUBIOBKTWNAT-VOTSOKGWSA-N. The full InChI is InChI=1S/C9H9GeO/c1-11-9-4-2-8(3-5-9)6-7-10/h2-7H,1H3/b7-6+.
What are the key properties of CID 135078844?
CID 135078844 has a molecular weight of 205.78 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 135078844 is sourced from PubChem (CID 135078844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).