C32H43O3S2+ — CID 173329790
4-[(2,6-ditert-butyl-3-sulfanylpyrylium-4-yl)methylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one (PubChem CID 173329790) has the molecular formula C32H43O3S2+ and a molecular weight of 539.83 g/mol. Its IUPAC name is 4-[(2,6-ditert-butyl-3-sulfanylpyrylium-4-yl)methylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one.
| Compound Name | 4-[(2,6-ditert-butyl-3-sulfanylpyrylium-4-yl)methylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 173329790 |
| Molecular Formula | C32H43O3S2+ |
| Molecular Weight | 539.83 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 4-[(2,6-ditert-butyl-3-sulfanylpyrylium-4-yl)methylidene]-2-[(2,6-ditert-butylthiopyran-4-ylidene)methyl]-3-hydroxycyclobut-2-en-1-one |
| SMILES | CC(C)(C)C1=CC(=CC2=C(O)C(=Cc3cc(C(C)(C)C)[o+]c(C(C)(C)C)c3S)C2=O)C=C(C(C)(C)C)S1 |
| InChI | InChI=1S/C32H42O3S2/c1-29(2,3)22-17-19(27(36)28(35-22)32(10,11)12)16-21-25(33)20(26(21)34)13-18-14-23(30(4,5)6)37-24(15-18)31(7,8)9/h13-17H,1-12H3,(H-,33,34,36)/p+1 |
| InChIKey | ITROVQCUQBWVMK-UHFFFAOYSA-O |
| XLogP | 9.76 |
| TPSA | 48.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.83 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|