C32H42O3S — CID 139245126
(4Z)-2-[(2,6-ditert-butylpyran-4-ylidene)methyl]-4-[(2,6-ditert-butylpyrylium-4-yl)methylidene]-3-oxocyclobutene-1-thiolate (PubChem CID 139245126) has the molecular formula C32H42O3S and a molecular weight of 506.75 g/mol. Its IUPAC name is (4Z)-2-[(2,6-ditert-butylpyran-4-ylidene)methyl]-4-[(2,6-ditert-butylpyrylium-4-yl)methylidene]-3-oxocyclobutene-1-thiolate.
| Compound Name | (4Z)-2-[(2,6-ditert-butylpyran-4-ylidene)methyl]-4-[(2,6-ditert-butylpyrylium-4-yl)methylidene]-3-oxocyclobutene-1-thiolate |
|---|---|
| PubChem CID | 139245126 |
| Molecular Formula | C32H42O3S |
| Molecular Weight | 506.75 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (4Z)-2-[(2,6-ditert-butylpyran-4-ylidene)methyl]-4-[(2,6-ditert-butylpyrylium-4-yl)methylidene]-3-oxocyclobutene-1-thiolate |
| SMILES | CC(C)(C)C1=CC(=CC2=C([S-])/C(=C\c3cc(C(C)(C)C)[o+]c(C(C)(C)C)c3)C2=O)C=C(C(C)(C)C)O1 |
| InChI | InChI=1S/C32H42O3S/c1-29(2,3)23-15-19(16-24(34-23)30(4,5)6)13-21-27(33)22(28(21)36)14-20-17-25(31(7,8)9)35-26(18-20)32(10,11)12/h13-18H,1-12H3 |
| InChIKey | FJNKIXTYBQKLSH-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.75 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|