C15H17S2+ — CID 59083508
4-[(2,6-dimethylthiopyran-4-ylidene)methyl]-2,6-dimethylthiopyrylium (PubChem CID 59083508) has the molecular formula C15H17S2+ and a molecular weight of 261.43 g/mol. Its IUPAC name is 4-[(2,6-dimethylthiopyran-4-ylidene)methyl]-2,6-dimethylthiopyrylium.
| Compound Name | 4-[(2,6-dimethylthiopyran-4-ylidene)methyl]-2,6-dimethylthiopyrylium |
|---|---|
| PubChem CID | 59083508 |
| Molecular Formula | C15H17S2+ |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4-[(2,6-dimethylthiopyran-4-ylidene)methyl]-2,6-dimethylthiopyrylium |
| SMILES | CC1=CC(=Cc2cc(C)[s+]c(C)c2)C=C(C)S1 |
| InChI | InChI=1S/C15H17S2/c1-10-5-14(6-11(2)16-10)9-15-7-12(3)17-13(4)8-15/h5-9H,1-4H3/q+1 |
| InChIKey | UJWRLIWFLHPZQZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|