About (3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene
(3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene (PubChem CID 139888618) has the molecular formula C13H12
and a molecular weight of 168.24 g/mol. Its IUPAC name is (3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene.
Analyze (3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene?
The IUPAC name of (3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene (CID 139888618) is (3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene.
What is the SMILES notation for (3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene?
The canonical SMILES for (3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene is CC1=CC(=Cc2ccccc2)C=C1.
What is the InChIKey of (3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene?
The InChIKey is JELOGUAFRXKECS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12/c1-11-7-8-13(9-11)10-12-5-3-2-4-6-12/h2-10H,1H3.
What are the key properties of (3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene?
(3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene has a molecular weight of 168.24 g/mol, XLogP of 3.59, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclopenta-2,4-dien-1-ylidene)methylbenzene is sourced from PubChem (CID 139888618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).