C16H12S2 — CID 101088005
2,4-dibenzylidene-1,3-dithietane (PubChem CID 101088005) has the molecular formula C16H12S2 and a molecular weight of 268.41 g/mol. Its IUPAC name is 2,4-dibenzylidene-1,3-dithietane.
| Compound Name | 2,4-dibenzylidene-1,3-dithietane |
|---|---|
| PubChem CID | 101088005 |
| Molecular Formula | C16H12S2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 2,4-dibenzylidene-1,3-dithietane |
| SMILES | C(c1ccccc1)=c1sc(=Cc2ccccc2)s1 |
| InChI | InChI=1S/C16H12S2/c1-3-7-13(8-4-1)11-15-17-16(18-15)12-14-9-5-2-6-10-14/h1-12H/b15-11-,16-12+ |
| InChIKey | CIBGYZQVNCFDMW-UKVBVZPVSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |