C13H12 — CID 54483415
cyclohexa-2,4-dien-1-ylidenemethylbenzene (PubChem CID 54483415) has the molecular formula C13H12 and a molecular weight of 168.24 g/mol. Its IUPAC name is cyclohexa-2,4-dien-1-ylidenemethylbenzene.
| Compound Name | cyclohexa-2,4-dien-1-ylidenemethylbenzene |
|---|---|
| PubChem CID | 54483415 |
| Molecular Formula | C13H12 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | cyclohexa-2,4-dien-1-ylidenemethylbenzene |
| SMILES | C1=CCC(=Cc2ccccc2)C=C1 |
| InChI | InChI=1S/C13H12/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1-9,11H,10H2 |
| InChIKey | ZTCZYTZOLQUGOY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |