About (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine
(Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine (PubChem CID 143168255) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine.
Molecular Properties
| Compound Name | (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine |
| PubChem CID | 143168255 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine |
| SMILES | CN/C(C)=C\C=C1\C=CC=CC1 |
| InChI | InChI=1S/C11H15N/c1-10(12-2)8-9-11-6-4-3-5-7-11/h3-6,8-9,12H,7H2,1-2H3/b10-8-,11-9- |
| InChIKey | IWNJJSPSWHEMHS-WGEIWTTOSA-N |
| XLogP | 2.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine?
The IUPAC name of (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine (CID 143168255) is (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine.
What is the SMILES notation for (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine?
The canonical SMILES for (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine is CN/C(C)=C\C=C1\C=CC=CC1.
What is the InChIKey of (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine?
The InChIKey is IWNJJSPSWHEMHS-WGEIWTTOSA-N. The full InChI is InChI=1S/C11H15N/c1-10(12-2)8-9-11-6-4-3-5-7-11/h3-6,8-9,12H,7H2,1-2H3/b10-8-,11-9-.
What are the key properties of (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine?
(Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine has a molecular weight of 161.25 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,4E)-4-cyclohexa-2,4-dien-1-ylidene-N-methylbut-2-en-2-amine is sourced from PubChem (CID 143168255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).