C10H11NO — CID 59876417
N-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]prop-2-en-1-imine oxide (PubChem CID 59876417) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is N-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]prop-2-en-1-imine oxide.
| Compound Name | N-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]prop-2-en-1-imine oxide |
|---|---|
| PubChem CID | 59876417 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | N-[(E)-cyclohexa-2,4-dien-1-ylidenemethyl]prop-2-en-1-imine oxide |
| SMILES | C=C/C=[N+]([O-])\C=C1\C=CC=CC1 |
| InChI | InChI=1S/C10H11NO/c1-2-8-11(12)9-10-6-4-3-5-7-10/h2-6,8-9H,1,7H2/b10-9-,11-8+ |
| InChIKey | NNMVMMIOIHUQAQ-LMMFKTOUSA-N |
| XLogP | 2.15 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|