C12H13N — CID 13172005
(5E)-5-benzylidene-3,4-dihydro-2H-pyridine (PubChem CID 13172005) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is (5E)-5-benzylidene-3,4-dihydro-2H-pyridine.
| Compound Name | (5E)-5-benzylidene-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 13172005 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (5E)-5-benzylidene-3,4-dihydro-2H-pyridine |
| SMILES | C1=NCCC/C1=C\c1ccccc1 |
| InChI | InChI=1S/C12H13N/c1-2-5-11(6-3-1)9-12-7-4-8-13-10-12/h1-3,5-6,9-10H,4,7-8H2/b12-9+ |
| InChIKey | DBPSQCKCIVSYTK-FMIVXFBMSA-N |
| XLogP | 2.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |