C17H15N — CID 71485632
(4Z)-4-benzylidene-5-phenyl-2,3-dihydropyrrole (PubChem CID 71485632) has the molecular formula C17H15N and a molecular weight of 233.31 g/mol. Its IUPAC name is (4Z)-4-benzylidene-5-phenyl-2,3-dihydropyrrole.
| Compound Name | (4Z)-4-benzylidene-5-phenyl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 71485632 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | (4Z)-4-benzylidene-5-phenyl-2,3-dihydropyrrole |
| SMILES | C(=C1/CCN=C1c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C17H15N/c1-3-7-14(8-4-1)13-16-11-12-18-17(16)15-9-5-2-6-10-15/h1-10,13H,11-12H2/b16-13- |
| InChIKey | XNNXUKQRNXYRDF-SSZFMOIBSA-N |
| XLogP | 3.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |