C36H28N4 — CID 15873330
3,4,9,10-tetraphenyl-2,5,8,11-tetrazabicyclo[10.4.0]hexadeca-1(16),2,4,8,10,12,14-heptaene (PubChem CID 15873330) has the molecular formula C36H28N4 and a molecular weight of 516.65 g/mol. Its IUPAC name is 3,4,9,10-tetraphenyl-2,5,8,11-tetrazabicyclo[10.4.0]hexadeca-1(16),2,4,8,10,12,14-heptaene.
| Compound Name | 3,4,9,10-tetraphenyl-2,5,8,11-tetrazabicyclo[10.4.0]hexadeca-1(16),2,4,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 15873330 |
| Molecular Formula | C36H28N4 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 3,4,9,10-tetraphenyl-2,5,8,11-tetrazabicyclo[10.4.0]hexadeca-1(16),2,4,8,10,12,14-heptaene |
| SMILES | c1ccc(C2=N/CC/N=C(c3ccccc3)\C(c3ccccc3)=N\c3ccccc3/N=C\2c2ccccc2)cc1 |
| InChI | InChI=1S/C36H28N4/c1-5-15-27(16-6-1)33-35(29-19-9-3-10-20-29)39-31-23-13-14-24-32(31)40-36(30-21-11-4-12-22-30)34(38-26-25-37-33)28-17-7-2-8-18-28/h1-24H,25-26H2/b37-33-,38-34-,39-35-,40-36+ |
| InChIKey | CMAMYKFPUCEBAI-RYTOLXTRSA-N |
| XLogP | 7.92 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |