C48H33Cl9N6 — CID 139206499
2-phenyl-4-(trichloromethyl)-3H-1,5-benzodiazepine (PubChem CID 139206499) has the molecular formula C48H33Cl9N6 and a molecular weight of 1012.91 g/mol. Its IUPAC name is 2-phenyl-4-(trichloromethyl)-3H-1,5-benzodiazepine.
| Compound Name | 2-phenyl-4-(trichloromethyl)-3H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 139206499 |
| Molecular Formula | C48H33Cl9N6 |
| Molecular Weight | 1012.91 g/mol |
| Exact Mass | 1008.00 |
| IUPAC Name | 2-phenyl-4-(trichloromethyl)-3H-1,5-benzodiazepine |
| SMILES | ClC(Cl)(Cl)C1=Nc2ccccc2N=C(c2ccccc2)C1.ClC(Cl)(Cl)C1=Nc2ccccc2N=C(c2ccccc2)C1.ClC(Cl)(Cl)C1=Nc2ccccc2N=C(c2ccccc2)C1 |
| InChI | InChI=1S/3C16H11Cl3N2/c3*17-16(18,19)15-10-14(11-6-2-1-3-7-11)20-12-8-4-5-9-13(12)21-15/h3*1-9H,10H2 |
| InChIKey | BZYHQTQXCZTZRO-UHFFFAOYSA-N |
| XLogP | 16.96 |
| TPSA | 74.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.91 |
| LogP ≤ 5 | 16.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|