About 2,4,5-triphenyl-3H-pyrrole
2,4,5-triphenyl-3H-pyrrole (PubChem CID 143156770) has the molecular formula C22H17N
and a molecular weight of 295.39 g/mol. Its IUPAC name is 2,4,5-triphenyl-3H-pyrrole.
Molecular Properties
| Compound Name | 2,4,5-triphenyl-3H-pyrrole |
| PubChem CID | 143156770 |
| Molecular Formula | C22H17N |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2,4,5-triphenyl-3H-pyrrole |
| SMILES | c1ccc(C2=NC(c3ccccc3)=C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H17N/c1-4-10-17(11-5-1)20-16-21(18-12-6-2-7-13-18)23-22(20)19-14-8-3-9-15-19/h1-15H,16H2 |
| InChIKey | GJNQZMMYZCESGJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2,4,5-triphenyl-3H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-triphenyl-3H-pyrrole?
The IUPAC name of 2,4,5-triphenyl-3H-pyrrole (CID 143156770) is 2,4,5-triphenyl-3H-pyrrole.
What is the SMILES notation for 2,4,5-triphenyl-3H-pyrrole?
The canonical SMILES for 2,4,5-triphenyl-3H-pyrrole is c1ccc(C2=NC(c3ccccc3)=C(c3ccccc3)C2)cc1.
What is the InChIKey of 2,4,5-triphenyl-3H-pyrrole?
The InChIKey is GJNQZMMYZCESGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N/c1-4-10-17(11-5-1)20-16-21(18-12-6-2-7-13-18)23-22(20)19-14-8-3-9-15-19/h1-15H,16H2.
What are the key properties of 2,4,5-triphenyl-3H-pyrrole?
2,4,5-triphenyl-3H-pyrrole has a molecular weight of 295.39 g/mol, XLogP of 5.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-triphenyl-3H-pyrrole is sourced from PubChem (CID 143156770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).