C14H12N2O2 — CID 157282326
6-methyl-2-phenyl-3,4-dihydropyrrolo[2,3-c]pyridine-5,7-dione (PubChem CID 157282326) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 6-methyl-2-phenyl-3,4-dihydropyrrolo[2,3-c]pyridine-5,7-dione.
| Compound Name | 6-methyl-2-phenyl-3,4-dihydropyrrolo[2,3-c]pyridine-5,7-dione |
|---|---|
| PubChem CID | 157282326 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 6-methyl-2-phenyl-3,4-dihydropyrrolo[2,3-c]pyridine-5,7-dione |
| SMILES | CN1C(=O)CC2=C(N=C(c3ccccc3)C2)C1=O |
| InChI | InChI=1S/C14H12N2O2/c1-16-12(17)8-10-7-11(15-13(10)14(16)18)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | SARFYWOHZGYAJY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|