About benzene;ethane;2-phenyl-3H-indole
benzene;ethane;2-phenyl-3H-indole (PubChem CID 91573421) has the molecular formula C24H29N
and a molecular weight of 331.50 g/mol. Its IUPAC name is benzene;ethane;2-phenyl-3H-indole.
Molecular Properties
| Compound Name | benzene;ethane;2-phenyl-3H-indole |
| PubChem CID | 91573421 |
| Molecular Formula | C24H29N |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | benzene;ethane;2-phenyl-3H-indole |
| SMILES | CC.CC.c1ccc(C2=Nc3ccccc3C2)cc1.c1ccccc1 |
| InChI | InChI=1S/C14H11N.C6H6.2C2H6/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14;1-2-4-6-5-3-1;2*1-2/h1-9H,10H2;1-6H;2*1-2H3 |
| InChIKey | AJPWVJCDDXMTIC-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;ethane;2-phenyl-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;ethane;2-phenyl-3H-indole?
The IUPAC name of benzene;ethane;2-phenyl-3H-indole (CID 91573421) is benzene;ethane;2-phenyl-3H-indole.
What is the SMILES notation for benzene;ethane;2-phenyl-3H-indole?
The canonical SMILES for benzene;ethane;2-phenyl-3H-indole is CC.CC.c1ccc(C2=Nc3ccccc3C2)cc1.c1ccccc1.
What is the InChIKey of benzene;ethane;2-phenyl-3H-indole?
The InChIKey is AJPWVJCDDXMTIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N.C6H6.2C2H6/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14;1-2-4-6-5-3-1;2*1-2/h1-9H,10H2;1-6H;2*1-2H3.
What are the key properties of benzene;ethane;2-phenyl-3H-indole?
benzene;ethane;2-phenyl-3H-indole has a molecular weight of 331.50 g/mol, XLogP of 7.10, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;ethane;2-phenyl-3H-indole is sourced from PubChem (CID 91573421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).